C29H27NO6 — CID 3662797
(3,3-dimethyl-2-oxobutyl) 2-[4-(2,6-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3662797) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-[4-(2,6-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-[4-(2,6-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3662797 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-[4-(2,6-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cccc(C)c1Oc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)C(C)(C)C)cc3C2=O)cc1 |
| InChI | InChI=1S/C29H27NO6/c1-17-7-6-8-18(2)25(17)36-21-12-10-20(11-13-21)30-26(32)22-14-9-19(15-23(22)27(30)33)28(34)35-16-24(31)29(3,4)5/h6-15H,16H2,1-5H3 |
| InChIKey | ISFFNMBEKPXDJU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|