C47H33NO8 — CID 174332628
benzyl 2-[4-[3-[3-[3-(4-methylphenoxy)phenoxy]phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 174332628) has the molecular formula C47H33NO8 and a molecular weight of 739.78 g/mol. Its IUPAC name is benzyl 2-[4-[3-[3-[3-(4-methylphenoxy)phenoxy]phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | benzyl 2-[4-[3-[3-[3-(4-methylphenoxy)phenoxy]phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 174332628 |
| Molecular Formula | C47H33NO8 |
| Molecular Weight | 739.78 g/mol |
| Exact Mass | 739.22 |
| IUPAC Name | benzyl 2-[4-[3-[3-[3-(4-methylphenoxy)phenoxy]phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(Oc2cccc(Oc3cccc(Oc4cccc(Oc5ccc(N6C(=O)c7ccc(C(=O)OCc8ccccc8)cc7C6=O)cc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C47H33NO8/c1-31-16-21-35(22-17-31)53-37-10-5-12-39(27-37)55-41-14-7-15-42(29-41)56-40-13-6-11-38(28-40)54-36-23-19-34(20-24-36)48-45(49)43-25-18-33(26-44(43)46(48)50)47(51)52-30-32-8-3-2-4-9-32/h2-29H,30H2,1H3 |
| InChIKey | KYNHRUXSELOVJW-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.78 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|