C22H13Cl2NO4 — CID 18276790
(3-chlorophenyl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 18276790) has the molecular formula C22H13Cl2NO4 and a molecular weight of 426.26 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 18276790 |
| Molecular Formula | C22H13Cl2NO4 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (3-chlorophenyl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCc1cccc(Cl)c1)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C22H13Cl2NO4/c23-15-5-7-17(8-6-15)25-20(26)18-9-4-14(11-19(18)21(25)27)22(28)29-12-13-2-1-3-16(24)10-13/h1-11H,12H2 |
| InChIKey | OTXFELTYRUCOJF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|