C23H13ClN2O5 — CID 29404753
1,3-benzoxazol-2-ylmethyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 29404753) has the molecular formula C23H13ClN2O5 and a molecular weight of 432.82 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 29404753 |
| Molecular Formula | C23H13ClN2O5 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2o1)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C23H13ClN2O5/c24-14-6-8-15(9-7-14)26-21(27)16-10-5-13(11-17(16)22(26)28)23(29)30-12-20-25-18-3-1-2-4-19(18)31-20/h1-11H,12H2 |
| InChIKey | HFTWONHWTMKORQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|