C27H18ClNO6 — CID 3315105
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3315105) has the molecular formula C27H18ClNO6 and a molecular weight of 487.90 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3315105 |
| Molecular Formula | C27H18ClNO6 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc4c(c3)C(=O)N(c3ccc(Cl)cc3)C4=O)cc(=O)oc2c1C |
| InChI | InChI=1S/C27H18ClNO6/c1-14-3-9-20-17(12-23(30)35-24(20)15(14)2)13-34-27(33)16-4-10-21-22(11-16)26(32)29(25(21)31)19-7-5-18(28)6-8-19/h3-12H,13H2,1-2H3 |
| InChIKey | JVLBGVYJTGWRBC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|