C26H18O7S — CID 3299798
(7,8-dimethyl-2-oxochromen-4-yl)methyl 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 3299798) has the molecular formula C26H18O7S and a molecular weight of 474.49 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 3299798 |
| Molecular Formula | C26H18O7S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc4c(c3)S(=O)(=O)c3ccccc3C4=O)cc(=O)oc2c1C |
| InChI | InChI=1S/C26H18O7S/c1-14-7-9-18-17(12-23(27)33-25(18)15(14)2)13-32-26(29)16-8-10-20-22(11-16)34(30,31)21-6-4-3-5-19(21)24(20)28/h3-12H,13H2,1-2H3 |
| InChIKey | NNXXCTMEFZMAOR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|