C22H16ClNO4 — CID 55730152
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-chloroquinoline-6-carboxylate (PubChem CID 55730152) has the molecular formula C22H16ClNO4 and a molecular weight of 393.83 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-chloroquinoline-6-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55730152 |
| Molecular Formula | C22H16ClNO4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-chloroquinoline-6-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc4nc(Cl)ccc4c3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H16ClNO4/c1-12-3-6-17-16(10-20(25)28-21(17)13(12)2)11-27-22(26)15-4-7-18-14(9-15)5-8-19(23)24-18/h3-10H,11H2,1-2H3 |
| InChIKey | OTCVIEZPCDTQTP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|