C25H21NO4 — CID 4235611
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (PubChem CID 4235611) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 4235611 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3c4c(nc5ccccc35)CCC4)cc(=O)oc2c1C |
| InChI | InChI=1S/C25H21NO4/c1-14-10-11-17-16(12-22(27)30-24(17)15(14)2)13-29-25(28)23-18-6-3-4-8-20(18)26-21-9-5-7-19(21)23/h3-4,6,8,10-12H,5,7,9,13H2,1-2H3 |
| InChIKey | VADDJTAEWRBNPG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|