C18H15NO4 — CID 2552705
(7,8-dimethyl-2-oxochromen-4-yl)methyl pyridine-2-carboxylate (PubChem CID 2552705) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl pyridine-2-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl pyridine-2-carboxylate |
|---|---|
| PubChem CID | 2552705 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl pyridine-2-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3ccccn3)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H15NO4/c1-11-6-7-14-13(9-16(20)23-17(14)12(11)2)10-22-18(21)15-5-3-4-8-19-15/h3-9H,10H2,1-2H3 |
| InChIKey | AUCMZOFBDNJNPD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|