C20H18O6S — CID 7744728
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-methylsulfonylbenzoate (PubChem CID 7744728) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-methylsulfonylbenzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7744728 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-methylsulfonylbenzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc(S(C)(=O)=O)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H18O6S/c1-12-4-9-17-15(10-18(21)26-19(17)13(12)2)11-25-20(22)14-5-7-16(8-6-14)27(3,23)24/h4-10H,11H2,1-3H3 |
| InChIKey | RGVFQEZFLMIZJD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|