C24H21NO7S — CID 3890109
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 3890109) has the molecular formula C24H21NO7S and a molecular weight of 467.50 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3890109 |
| Molecular Formula | C24H21NO7S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc(S(=O)(=O)NCc4ccco4)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H21NO7S/c1-15-5-10-21-18(12-22(26)32-23(21)16(15)2)14-31-24(27)17-6-8-20(9-7-17)33(28,29)25-13-19-4-3-11-30-19/h3-12,25H,13-14H2,1-2H3 |
| InChIKey | LCDZPEMGUAOBOP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|