C23H25NO4 — CID 3880003
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(diethylamino)benzoate (PubChem CID 3880003) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(diethylamino)benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 3880003 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCc2cc(=O)oc3c(C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-5-24(6-2)19-10-8-17(9-11-19)23(26)27-14-18-13-21(25)28-22-16(4)15(3)7-12-20(18)22/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | VFIHQIIVBIMUAC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|