C26H21ClO4S — CID 3441264
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 3441264) has the molecular formula C26H21ClO4S and a molecular weight of 464.97 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 3441264 |
| Molecular Formula | C26H21ClO4S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc(CSc4ccc(Cl)cc4)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C26H21ClO4S/c1-16-3-12-23-20(13-24(28)31-25(23)17(16)2)14-30-26(29)19-6-4-18(5-7-19)15-32-22-10-8-21(27)9-11-22/h3-13H,14-15H2,1-2H3 |
| InChIKey | RIXKURBLSFFEIQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|