C27H25NO6S — CID 2464201
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,4-dimethylphenyl)sulfonylamino]benzoate (PubChem CID 2464201) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,4-dimethylphenyl)sulfonylamino]benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,4-dimethylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2464201 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,4-dimethylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)OCc3cc(=O)oc4c(C)c(C)ccc34)cc2)cc1C |
| InChI | InChI=1S/C27H25NO6S/c1-16-5-11-23(13-18(16)3)35(31,32)28-22-9-7-20(8-10-22)27(30)33-15-21-14-25(29)34-26-19(4)17(2)6-12-24(21)26/h5-14,28H,15H2,1-4H3 |
| InChIKey | QFMAZUSQYALDIV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|