C25H27NO6S — CID 5109449
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 5109449) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 5109449 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)OCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C25H27NO6S/c1-16-8-10-21-19(13-23(27)32-24(21)18(16)3)15-31-25(28)22-14-20(9-7-17(22)2)33(29,30)26-11-5-4-6-12-26/h7-10,13-14H,4-6,11-12,15H2,1-3H3 |
| InChIKey | JOYSYALSVJWADI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|