C24H22ClNO6S — CID 31851924
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 31851924) has the molecular formula C24H22ClNO6S and a molecular weight of 487.96 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 31851924 |
| Molecular Formula | C24H22ClNO6S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cc(=O)oc2cc3c(cc12)CCC3)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C24H22ClNO6S/c25-21-7-6-18(33(29,30)26-8-1-2-9-26)13-20(21)24(28)31-14-17-12-23(27)32-22-11-16-5-3-4-15(16)10-19(17)22/h6-7,10-13H,1-5,8-9,14H2 |
| InChIKey | KQDRELNZVSFWDN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|