C23H25N2O4S+ — CID 2655633
4-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one (PubChem CID 2655633) has the molecular formula C23H25N2O4S+ and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one.
| Compound Name | 4-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
|---|---|
| PubChem CID | 2655633 |
| Molecular Formula | C23H25N2O4S+ |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
| SMILES | O=c1cc(C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)c2cc3c(cc2o1)CCC3 |
| InChI | InChI=1S/C23H24N2O4S/c26-23-15-19(21-13-17-5-4-6-18(17)14-22(21)29-23)16-24-9-11-25(12-10-24)30(27,28)20-7-2-1-3-8-20/h1-3,7-8,13-15H,4-6,9-12,16H2/p+1 |
| InChIKey | OSQJDGMTJHVFPX-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|