C27H26N2O4S — CID 2461285
4-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one (PubChem CID 2461285) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is 4-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one.
| Compound Name | 4-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
|---|---|
| PubChem CID | 2461285 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
| SMILES | O=c1cc(CN2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)c2cc3c(cc2o1)CCC3 |
| InChI | InChI=1S/C27H26N2O4S/c30-27-17-23(25-15-21-6-3-7-22(21)16-26(25)33-27)18-28-10-12-29(13-11-28)34(31,32)24-9-8-19-4-1-2-5-20(19)14-24/h1-2,4-5,8-9,14-17H,3,6-7,10-13,18H2 |
| InChIKey | CJFCPTSQXGXANI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|