C22H22N2O5S — CID 42994897
6-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 42994897) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 6-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 42994897 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 6-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCN(Cc2cc3c(cc2O)OCO3)CC1 |
| InChI | InChI=1S/C22H22N2O5S/c25-20-13-22-21(28-15-29-22)12-18(20)14-23-7-9-24(10-8-23)30(26,27)19-6-5-16-3-1-2-4-17(16)11-19/h1-6,11-13,25H,7-10,14-15H2 |
| InChIKey | BLBUNGFMIZETBN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|