C21H20ClFN2O2S — CID 22208128
1-[(3-chloro-4-fluorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine (PubChem CID 22208128) has the molecular formula C21H20ClFN2O2S and a molecular weight of 418.92 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 22208128 |
| Molecular Formula | C21H20ClFN2O2S |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCN(Cc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H20ClFN2O2S/c22-20-13-16(5-8-21(20)23)15-24-9-11-25(12-10-24)28(26,27)19-7-6-17-3-1-2-4-18(17)14-19/h1-8,13-14H,9-12,15H2 |
| InChIKey | WASKTTZQBGCQGS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |