C22H21F3N2O2S — CID 17023784
1-naphthalen-2-ylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 17023784) has the molecular formula C22H21F3N2O2S and a molecular weight of 434.48 g/mol. Its IUPAC name is 1-naphthalen-2-ylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-naphthalen-2-ylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 17023784 |
| Molecular Formula | C22H21F3N2O2S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1-naphthalen-2-ylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H21F3N2O2S/c23-22(24,25)20-7-3-4-17(14-20)16-26-10-12-27(13-11-26)30(28,29)21-9-8-18-5-1-2-6-19(18)15-21/h1-9,14-15H,10-13,16H2 |
| InChIKey | ASBQWSVZCLFNOY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |