C21H20Cl2N2O2S — CID 1282318
1-[(2,6-dichlorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine (PubChem CID 1282318) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 1282318 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCN(Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c22-20-6-3-7-21(23)19(20)15-24-10-12-25(13-11-24)28(26,27)18-9-8-16-4-1-2-5-17(16)14-18/h1-9,14H,10-13,15H2 |
| InChIKey | DKCXZMWVENTKRR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |