C23H23N3O8S — CID 2901433
1-naphthalen-2-ylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid (PubChem CID 2901433) has the molecular formula C23H23N3O8S and a molecular weight of 501.52 g/mol. Its IUPAC name is 1-naphthalen-2-ylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-naphthalen-2-ylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 2901433 |
| Molecular Formula | C23H23N3O8S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 1-naphthalen-2-ylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=[N+]([O-])c1cccc(CN2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C21H21N3O4S.C2H2O4/c25-24(26)20-7-3-4-17(14-20)16-22-10-12-23(13-11-22)29(27,28)21-9-8-18-5-1-2-6-19(18)15-21;3-1(4)2(5)6/h1-9,14-15H,10-13,16H2;(H,3,4)(H,5,6) |
| InChIKey | SJBXCWPFGQFWCO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|