C15H21N3O8S — CID 2900147
1-ethylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid (PubChem CID 2900147) has the molecular formula C15H21N3O8S and a molecular weight of 403.41 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-ethylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 2900147 |
| Molecular Formula | C15H21N3O8S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 1-ethylsulfonyl-4-[(3-nitrophenyl)methyl]piperazine;oxalic acid |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cccc([N+](=O)[O-])c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19N3O4S.C2H2O4/c1-2-21(19,20)15-8-6-14(7-9-15)11-12-4-3-5-13(10-12)16(17)18;3-1(4)2(5)6/h3-5,10H,2,6-9,11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | FVUHWCGZPQPFHQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|