C18H21N3O4S — CID 1364878
1-(4-methylphenyl)sulfonyl-4-[(3-nitrophenyl)methyl]piperazine (PubChem CID 1364878) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-[(3-nitrophenyl)methyl]piperazine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-[(3-nitrophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 1364878 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-[(3-nitrophenyl)methyl]piperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3cccc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-15-5-7-18(8-6-15)26(24,25)20-11-9-19(10-12-20)14-16-3-2-4-17(13-16)21(22)23/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | XVLNFKALWMDCJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|