C25H25ClN4O5S — CID 43926137
N-(2-chloro-5-nitrophenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide (PubChem CID 43926137) has the molecular formula C25H25ClN4O5S and a molecular weight of 529.02 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 43926137 |
| Molecular Formula | C25H25ClN4O5S |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3cccc(C(=O)Nc4cc([N+](=O)[O-])ccc4Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C25H25ClN4O5S/c1-18-5-8-22(9-6-18)36(34,35)29-13-11-28(12-14-29)17-19-3-2-4-20(15-19)25(31)27-24-16-21(30(32)33)7-10-23(24)26/h2-10,15-16H,11-14,17H2,1H3,(H,27,31) |
| InChIKey | REBHWDYHORGUJS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|