C30H36N4O5S — CID 43925538
N-(3-methoxypropyl)-2-[[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzamide (PubChem CID 43925538) has the molecular formula C30H36N4O5S and a molecular weight of 564.71 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzamide.
| Compound Name | N-(3-methoxypropyl)-2-[[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 43925538 |
| Molecular Formula | C30H36N4O5S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | N-(3-methoxypropyl)-2-[[3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1ccccc1NC(=O)c1cccc(CN2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C30H36N4O5S/c1-23-11-13-26(14-12-23)40(37,38)34-18-16-33(17-19-34)22-24-7-5-8-25(21-24)29(35)32-28-10-4-3-9-27(28)30(36)31-15-6-20-39-2/h3-5,7-14,21H,6,15-20,22H2,1-2H3,(H,31,36)(H,32,35) |
| InChIKey | VDIGOETZLCINNI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|