C18H19Cl2N3O4S — CID 56582049
1-[(3,4-dichlorophenyl)methylsulfonyl]-4-[(3-nitrophenyl)methyl]piperazine (PubChem CID 56582049) has the molecular formula C18H19Cl2N3O4S and a molecular weight of 444.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]-4-[(3-nitrophenyl)methyl]piperazine.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-4-[(3-nitrophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 56582049 |
| Molecular Formula | C18H19Cl2N3O4S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-4-[(3-nitrophenyl)methyl]piperazine |
| SMILES | O=[N+]([O-])c1cccc(CN2CCN(S(=O)(=O)Cc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C18H19Cl2N3O4S/c19-17-5-4-15(11-18(17)20)13-28(26,27)22-8-6-21(7-9-22)12-14-2-1-3-16(10-14)23(24)25/h1-5,10-11H,6-9,12-13H2 |
| InChIKey | RPTUBJZQQMKHQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|