C20H21N5O5S — CID 55625629
5-[(4-benzylsulfonylpiperazin-1-yl)methyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 55625629) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 5-[(4-benzylsulfonylpiperazin-1-yl)methyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(4-benzylsulfonylpiperazin-1-yl)methyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55625629 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 5-[(4-benzylsulfonylpiperazin-1-yl)methyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2noc(CN3CCN(S(=O)(=O)Cc4ccccc4)CC3)n2)c1 |
| InChI | InChI=1S/C20H21N5O5S/c26-25(27)18-8-4-7-17(13-18)20-21-19(30-22-20)14-23-9-11-24(12-10-23)31(28,29)15-16-5-2-1-3-6-16/h1-8,13H,9-12,14-15H2 |
| InChIKey | XSLSFAMUZMLWFW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 122.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|