C19H18ClN5O3S — CID 2797585
5-[(1-benzyl-4,5-dihydroimidazol-2-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 2797585) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is 5-[(1-benzyl-4,5-dihydroimidazol-2-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-[(1-benzyl-4,5-dihydroimidazol-2-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 2797585 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 5-[(1-benzyl-4,5-dihydroimidazol-2-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc(-c2noc(CSC3=NCCN3Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H17N5O3S.ClH/c25-24(26)16-8-4-7-15(11-16)18-21-17(27-22-18)13-28-19-20-9-10-23(19)12-14-5-2-1-3-6-14;/h1-8,11H,9-10,12-13H2;1H |
| InChIKey | NYUMLENDFBQVBE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|