C16H11N5O3S — CID 39066638
5-(imidazo[1,5-a]pyridin-3-ylsulfanylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 39066638) has the molecular formula C16H11N5O3S and a molecular weight of 353.36 g/mol. Its IUPAC name is 5-(imidazo[1,5-a]pyridin-3-ylsulfanylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(imidazo[1,5-a]pyridin-3-ylsulfanylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 39066638 |
| Molecular Formula | C16H11N5O3S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 5-(imidazo[1,5-a]pyridin-3-ylsulfanylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2noc(CSc3ncc4ccccn34)n2)c1 |
| InChI | InChI=1S/C16H11N5O3S/c22-21(23)12-6-3-4-11(8-12)15-18-14(24-19-15)10-25-16-17-9-13-5-1-2-7-20(13)16/h1-9H,10H2 |
| InChIKey | DEPJZVJOZGJYKG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|