C14H12N6O3S — CID 39073389
5-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 39073389) has the molecular formula C14H12N6O3S and a molecular weight of 344.36 g/mol. Its IUPAC name is 5-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 39073389 |
| Molecular Formula | C14H12N6O3S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2noc(CSc3n[nH]c(C4CC4)n3)n2)c1 |
| InChI | InChI=1S/C14H12N6O3S/c21-20(22)10-3-1-2-9(6-10)13-15-11(23-19-13)7-24-14-16-12(17-18-14)8-4-5-8/h1-3,6,8H,4-5,7H2,(H,16,17,18) |
| InChIKey | BITDCSOSZSBCGJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|