C14H14N6O3S2 — CID 39069481
5-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 39069481) has the molecular formula C14H14N6O3S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 5-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-propyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-propyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 39069481 |
| Molecular Formula | C14H14N6O3S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 5-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-N-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNc1nnc(SCc2nc(-c3cccc([N+](=O)[O-])c3)no2)s1 |
| InChI | InChI=1S/C14H14N6O3S2/c1-2-6-15-13-17-18-14(25-13)24-8-11-16-12(19-23-11)9-4-3-5-10(7-9)20(21)22/h3-5,7H,2,6,8H2,1H3,(H,15,17) |
| InChIKey | GKWANXZGJWRXJM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|