C18H14N6O4S2 — CID 55733096
N-(3-methoxyphenyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 55733096) has the molecular formula C18H14N6O4S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3-methoxyphenyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 55733096 |
| Molecular Formula | C18H14N6O4S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | N-(3-methoxyphenyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cccc(Nc2nnc(SCc3nc(-c4ccc([N+](=O)[O-])cc4)no3)s2)c1 |
| InChI | InChI=1S/C18H14N6O4S2/c1-27-14-4-2-3-12(9-14)19-17-21-22-18(30-17)29-10-15-20-16(23-28-15)11-5-7-13(8-6-11)24(25)26/h2-9H,10H2,1H3,(H,19,21) |
| InChIKey | KVBMRJLJTVHGMG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|