C12H9N5O3S2 — CID 139073448
5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 139073448) has the molecular formula C12H9N5O3S2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 139073448 |
| Molecular Formula | C12H9N5O3S2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1nnc(SCc2nc(-c3ccc([N+](=O)[O-])cc3)no2)s1 |
| InChI | InChI=1S/C12H9N5O3S2/c1-7-14-15-12(22-7)21-6-10-13-11(16-20-10)8-2-4-9(5-3-8)17(18)19/h2-5H,6H2,1H3 |
| InChIKey | YPOSAXUMSHABMA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|