C19H23N7O4S — CID 55733277
4-[4-(2-methylpropyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-3-yl]morpholine (PubChem CID 55733277) has the molecular formula C19H23N7O4S and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[4-(2-methylpropyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[4-(2-methylpropyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 55733277 |
| Molecular Formula | C19H23N7O4S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[4-(2-methylpropyl)-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-3-yl]morpholine |
| SMILES | CC(C)Cn1c(SCc2nc(-c3ccc([N+](=O)[O-])cc3)no2)nnc1N1CCOCC1 |
| InChI | InChI=1S/C19H23N7O4S/c1-13(2)11-25-18(24-7-9-29-10-8-24)21-22-19(25)31-12-16-20-17(23-30-16)14-3-5-15(6-4-14)26(27)28/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | KJQZCGFTLANXQW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 125.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|