C17H17N7O4S — CID 55772192
3-[3-cyclopropyl-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-4-yl]propanamide (PubChem CID 55772192) has the molecular formula C17H17N7O4S and a molecular weight of 415.44 g/mol. Its IUPAC name is 3-[3-cyclopropyl-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-4-yl]propanamide.
| Compound Name | 3-[3-cyclopropyl-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 55772192 |
| Molecular Formula | C17H17N7O4S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-[3-cyclopropyl-5-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,2,4-triazol-4-yl]propanamide |
| SMILES | NC(=O)CCn1c(SCc2nc(-c3ccc([N+](=O)[O-])cc3)no2)nnc1C1CC1 |
| InChI | InChI=1S/C17H17N7O4S/c18-13(25)7-8-23-16(11-1-2-11)20-21-17(23)29-9-14-19-15(22-28-14)10-3-5-12(6-4-10)24(26)27/h3-6,11H,1-2,7-9H2,(H2,18,25) |
| InChIKey | ZFWSBSKARWPBCS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|