C21H17N7O3S — CID 55733191
3-(4-nitrophenyl)-5-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 55733191) has the molecular formula C21H17N7O3S and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-5-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-nitrophenyl)-5-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55733191 |
| Molecular Formula | C21H17N7O3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-(4-nitrophenyl)-5-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | CCCn1c2ccccc2c2nnc(SCc3nc(-c4ccc([N+](=O)[O-])cc4)no3)nc21 |
| InChI | InChI=1S/C21H17N7O3S/c1-2-11-27-16-6-4-3-5-15(16)18-20(27)23-21(25-24-18)32-12-17-22-19(26-31-17)13-7-9-14(10-8-13)28(29)30/h3-10H,2,11-12H2,1H3 |
| InChIKey | LNZBJIIIMSAXFM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 125.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|