C14H9N7O3S — CID 46481822
3-(4-nitrophenyl)-5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-1,2,4-oxadiazole (PubChem CID 46481822) has the molecular formula C14H9N7O3S and a molecular weight of 355.34 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-nitrophenyl)-5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46481822 |
| Molecular Formula | C14H9N7O3S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3-(4-nitrophenyl)-5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(CSc3nc4ncccn4n3)n2)cc1 |
| InChI | InChI=1S/C14H9N7O3S/c22-21(23)10-4-2-9(3-5-10)12-16-11(24-19-12)8-25-14-17-13-15-6-1-7-20(13)18-14/h1-7H,8H2 |
| InChIKey | NMLGYCMYERFEPR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 125.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|