C24H17FN6O3S — CID 46481864
5-[[4-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 46481864) has the molecular formula C24H17FN6O3S and a molecular weight of 488.50 g/mol. Its IUPAC name is 5-[[4-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[4-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46481864 |
| Molecular Formula | C24H17FN6O3S |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 5-[[4-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(CSc3nnc(-c4ccc(F)cc4)n3Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H17FN6O3S/c25-19-10-6-18(7-11-19)23-27-28-24(30(23)14-16-4-2-1-3-5-16)35-15-21-26-22(29-34-21)17-8-12-20(13-9-17)31(32)33/h1-13H,14-15H2 |
| InChIKey | HCXADOMCNYGEEN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|