C18H18N6OS — CID 46482340
3-(4-methylphenyl)-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 46482340) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-methylphenyl)-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46482340 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-(4-methylphenyl)-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(CSc3nc4nc(C)c(C)c(C)n4n3)n2)cc1 |
| InChI | InChI=1S/C18H18N6OS/c1-10-5-7-14(8-6-10)16-20-15(25-23-16)9-26-18-21-17-19-12(3)11(2)13(4)24(17)22-18/h5-8H,9H2,1-4H3 |
| InChIKey | QODFATNKOJHRLU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |