C17H16N6OS — CID 38079955
5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3-(3-methylphenyl)-1,2,4-oxadiazole (PubChem CID 38079955) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is 5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3-(3-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3-(3-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 38079955 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3-(3-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-c2noc(CSc3nc4nc(C)cc(C)n4n3)n2)c1 |
| InChI | InChI=1S/C17H16N6OS/c1-10-5-4-6-13(7-10)15-19-14(24-22-15)9-25-17-20-16-18-11(2)8-12(3)23(16)21-17/h4-8H,9H2,1-3H3 |
| InChIKey | PRBFBJCBHYKUSI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |