C19H18F2N6O3S — CID 55866517
3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 55866517) has the molecular formula C19H18F2N6O3S and a molecular weight of 448.46 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55866517 |
| Molecular Formula | C19H18F2N6O3S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2noc(CSc3nc4nc(C)c(C)c(C)n4n3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C19H18F2N6O3S/c1-9-10(2)22-18-24-19(25-27(18)11(9)3)31-8-15-23-16(26-30-15)12-5-6-13(29-17(20)21)14(7-12)28-4/h5-7,17H,8H2,1-4H3 |
| InChIKey | MGIYYAUFIFSOBG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 100.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |