C18H15F2N5O4S2 — CID 46543167
2-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole (PubChem CID 46543167) has the molecular formula C18H15F2N5O4S2 and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 46543167 |
| Molecular Formula | C18H15F2N5O4S2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 2-[[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole |
| SMILES | COc1cc(-c2noc(CSc3nnc(-c4sc(C)nc4C)o3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C18H15F2N5O4S2/c1-8-14(31-9(2)21-8)16-23-24-18(28-16)30-7-13-22-15(25-29-13)10-4-5-11(27-17(19)20)12(6-10)26-3/h4-6,17H,7H2,1-3H3 |
| InChIKey | RNCNSFLIRAMGGX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |