C18H18N6O3S — CID 9441375
3-(2,4-dimethoxyphenyl)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 9441375) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 9441375 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(CSc3nc4nc(C)cc(C)n4n3)n2)c(OC)c1 |
| InChI | InChI=1S/C18H18N6O3S/c1-10-7-11(2)24-17(19-10)21-18(22-24)28-9-15-20-16(23-27-15)13-6-5-12(25-3)8-14(13)26-4/h5-8H,9H2,1-4H3 |
| InChIKey | YFJOKOANRBIQIX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |