C18H15N5O3S2 — CID 55772013
3-(4-nitrophenyl)-5-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 55772013) has the molecular formula C18H15N5O3S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-5-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-nitrophenyl)-5-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55772013 |
| Molecular Formula | C18H15N5O3S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 3-(4-nitrophenyl)-5-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | Cc1nc(SCc2nc(-c3ccc([N+](=O)[O-])cc3)no2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C18H15N5O3S2/c1-9-10(2)28-18-15(9)17(19-11(3)20-18)27-8-14-21-16(22-26-14)12-4-6-13(7-5-12)23(24)25/h4-7H,8H2,1-3H3 |
| InChIKey | RRCREBJGGSEAFL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 107.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|