C19H17N5O4S2 — CID 37059540
3-ethyl-5,6-dimethyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 37059540) has the molecular formula C19H17N5O4S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-5,6-dimethyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 37059540 |
| Molecular Formula | C19H17N5O4S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(SCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C19H17N5O4S2/c1-4-23-18(25)15-10(2)11(3)30-17(15)20-19(23)29-9-14-21-22-16(28-14)12-5-7-13(8-6-12)24(26)27/h5-8H,4,9H2,1-3H3 |
| InChIKey | ZEGQSJBZOCTFDV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|