C21H23N5O5S2 — CID 40781994
N'-[2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]-4-nitrobenzohydrazide (PubChem CID 40781994) has the molecular formula C21H23N5O5S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N'-[2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 40781994 |
| Molecular Formula | C21H23N5O5S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N'-[2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]-4-nitrobenzohydrazide |
| SMILES | CCCCn1c(SCC(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C21H23N5O5S2/c1-4-5-10-25-20(29)17-12(2)13(3)33-19(17)22-21(25)32-11-16(27)23-24-18(28)14-6-8-15(9-7-14)26(30)31/h6-9H,4-5,10-11H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | AIHUZXMTRODUMY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|