C19H29N3O2S2 — CID 78682808
2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-heptan-2-ylacetamide (PubChem CID 78682808) has the molecular formula C19H29N3O2S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-heptan-2-ylacetamide.
| Compound Name | 2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-heptan-2-ylacetamide |
|---|---|
| PubChem CID | 78682808 |
| Molecular Formula | C19H29N3O2S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-heptan-2-ylacetamide |
| SMILES | CCCCCC(C)NC(=O)CSc1nc2sc(C)c(C)c2c(=O)n1CC |
| InChI | InChI=1S/C19H29N3O2S2/c1-6-8-9-10-12(3)20-15(23)11-25-19-21-17-16(13(4)14(5)26-17)18(24)22(19)7-2/h12H,6-11H2,1-5H3,(H,20,23) |
| InChIKey | FUXQSUKUWBBDGY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|