C19H29N3O3S2 — CID 55883687
2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide (PubChem CID 55883687) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide.
| Compound Name | 2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55883687 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-(3-ethyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide |
| SMILES | CCn1c(SCC(=O)NCCOCCC(C)C)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C19H29N3O3S2/c1-6-22-18(24)16-13(4)14(5)27-17(16)21-19(22)26-11-15(23)20-8-10-25-9-7-12(2)3/h12H,6-11H2,1-5H3,(H,20,23) |
| InChIKey | RQZOBEVTUWHTDW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|